C34H39N3O5 — CID 3427227
N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(3-methoxypropyl)benzamide (PubChem CID 3427227) has the molecular formula C34H39N3O5 and a molecular weight of 569.70 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3427227 |
| Molecular Formula | C34H39N3O5 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1ccccc1)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C34H39N3O5/c1-40-21-11-20-36(34(39)29-17-18-31(41-2)32(22-29)42-3)26-33(38)37(24-28-14-8-5-9-15-28)25-30-16-10-19-35(30)23-27-12-6-4-7-13-27/h4-10,12-19,22H,11,20-21,23-26H2,1-3H3 |
| InChIKey | YNARTDLNRUFVTG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|