C24H33BrN2O — CID 42763555
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylhexanamide (PubChem CID 42763555) has the molecular formula C24H33BrN2O and a molecular weight of 445.45 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylhexanamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylhexanamide |
|---|---|
| PubChem CID | 42763555 |
| Molecular Formula | C24H33BrN2O |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexylhexanamide |
| SMILES | CCCCCC(=O)N(Cc1cccn1Cc1ccc(Br)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H33BrN2O/c1-2-3-5-12-24(28)27(22-9-6-4-7-10-22)19-23-11-8-17-26(23)18-20-13-15-21(25)16-14-20/h8,11,13-17,22H,2-7,9-10,12,18-19H2,1H3 |
| InChIKey | VLVHRHVWDITPFA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|