C26H38N4O2 — CID 4306791
N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-[ethylcarbamoyl(propyl)amino]acetamide (PubChem CID 4306791) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-[ethylcarbamoyl(propyl)amino]acetamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-[ethylcarbamoyl(propyl)amino]acetamide |
|---|---|
| PubChem CID | 4306791 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-cyclohexyl-2-[ethylcarbamoyl(propyl)amino]acetamide |
| SMILES | CCCN(CC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1)C(=O)NCC |
| InChI | InChI=1S/C26H38N4O2/c1-3-17-29(26(32)27-4-2)21-25(31)30(23-14-9-6-10-15-23)20-24-16-11-18-28(24)19-22-12-7-5-8-13-22/h5,7-8,11-13,16,18,23H,3-4,6,9-10,14-15,17,19-21H2,1-2H3,(H,27,32) |
| InChIKey | QSFICPRTAYRHNT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |