C28H42N4O2 — CID 4000473
N-[(1-benzylpyrrol-2-yl)methyl]-2-[tert-butylcarbamoyl(propyl)amino]-N-cyclohexylacetamide (PubChem CID 4000473) has the molecular formula C28H42N4O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-2-[tert-butylcarbamoyl(propyl)amino]-N-cyclohexylacetamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-[tert-butylcarbamoyl(propyl)amino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 4000473 |
| Molecular Formula | C28H42N4O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-[tert-butylcarbamoyl(propyl)amino]-N-cyclohexylacetamide |
| SMILES | CCCN(CC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C28H42N4O2/c1-5-18-31(27(34)29-28(2,3)4)22-26(33)32(24-15-10-7-11-16-24)21-25-17-12-19-30(25)20-23-13-8-6-9-14-23/h6,8-9,12-14,17,19,24H,5,7,10-11,15-16,18,20-22H2,1-4H3,(H,29,34) |
| InChIKey | OZQFMOGRRHPTBS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |