C29H36N4O6 — CID 42664463
N-[2-[tert-butyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 42664463) has the molecular formula C29H36N4O6 and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[2-[tert-butyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | N-[2-[tert-butyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 42664463 |
| Molecular Formula | C29H36N4O6 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | N-[2-[tert-butyl-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | COCCN(CC(=O)N(Cc1cccn1Cc1cccc(OC)c1)C(C)(C)C)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H36N4O6/c1-29(2,3)32(20-25-12-8-14-30(25)19-22-9-6-13-26(17-22)39-5)27(34)21-31(15-16-38-4)28(35)23-10-7-11-24(18-23)33(36)37/h6-14,17-18H,15-16,19-21H2,1-5H3 |
| InChIKey | IQAQRGCDXVQAOM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 107.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|