C28H28N2O3 — CID 3975484
N-benzyl-3-methoxy-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 3975484) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-benzyl-3-methoxy-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | N-benzyl-3-methoxy-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3975484 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-benzyl-3-methoxy-N-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | COc1cccc(Cn2cccc2CN(Cc2ccccc2)C(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C28H28N2O3/c1-32-26-14-6-11-23(17-26)20-29-16-8-13-25(29)21-30(19-22-9-4-3-5-10-22)28(31)24-12-7-15-27(18-24)33-2/h3-18H,19-21H2,1-2H3 |
| InChIKey | KEOBFIBHGNVWGL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |