C23H25ClN2O2 — CID 3448969
3-chloro-N-(2-methoxyethyl)-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide (PubChem CID 3448969) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxyethyl)-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide.
| Compound Name | 3-chloro-N-(2-methoxyethyl)-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3448969 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-chloro-N-(2-methoxyethyl)-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzamide |
| SMILES | COCCN(Cc1cccn1Cc1ccc(C)cc1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O2/c1-18-8-10-19(11-9-18)16-25-12-4-7-22(25)17-26(13-14-28-2)23(27)20-5-3-6-21(24)15-20/h3-12,15H,13-14,16-17H2,1-2H3 |
| InChIKey | QTVYDAGGSCJEHO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |