C21H23FN2OS — CID 4541066
N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 4541066) has the molecular formula C21H23FN2OS and a molecular weight of 370.49 g/mol. Its IUPAC name is N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4541066 |
| Molecular Formula | C21H23FN2OS |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | CCCCN(Cc1cccn1Cc1cccc(F)c1)C(=O)c1cccs1 |
| InChI | InChI=1S/C21H23FN2OS/c1-2-3-11-24(21(25)20-10-6-13-26-20)16-19-9-5-12-23(19)15-17-7-4-8-18(22)14-17/h4-10,12-14H,2-3,11,15-16H2,1H3 |
| InChIKey | ZEYPIOVEZHBJKN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |