C26H37ClN2O — CID 7330855
(2R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-ethylhexanamide (PubChem CID 7330855) has the molecular formula C26H37ClN2O and a molecular weight of 429.05 g/mol. Its IUPAC name is (2R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-ethylhexanamide.
| Compound Name | (2R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-ethylhexanamide |
|---|---|
| PubChem CID | 7330855 |
| Molecular Formula | C26H37ClN2O |
| Molecular Weight | 429.05 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (2R)-N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-ethylhexanamide |
| SMILES | CCCC[C@@H](CC)C(=O)N(Cc1cccn1Cc1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H37ClN2O/c1-3-5-12-22(4-2)26(30)29(24-14-7-6-8-15-24)20-25-16-10-17-28(25)19-21-11-9-13-23(27)18-21/h9-11,13,16-18,22,24H,3-8,12,14-15,19-20H2,1-2H3/t22-/m1/s1 |
| InChIKey | YUTVZTUPISJRMR-JOCHJYFZSA-N |
| XLogP | 7.07 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.05 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |