C28H33ClN2O — CID 3975423
N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-phenylbutanamide (PubChem CID 3975423) has the molecular formula C28H33ClN2O and a molecular weight of 449.04 g/mol. Its IUPAC name is N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-phenylbutanamide.
| Compound Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 3975423 |
| Molecular Formula | C28H33ClN2O |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-2-phenylbutanamide |
| SMILES | CCC(C(=O)N(Cc1cccn1Cc1cccc(Cl)c1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H33ClN2O/c1-2-27(23-12-5-3-6-13-23)28(32)31(25-15-7-4-8-16-25)21-26-17-10-18-30(26)20-22-11-9-14-24(29)19-22/h3,5-6,9-14,17-19,25,27H,2,4,7-8,15-16,20-21H2,1H3 |
| InChIKey | SWWMVTMWKQTAKZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |