C23H22F3N3O — CID 3550889
1-[(1-benzylpyrrol-2-yl)methyl]-1-cyclopropyl-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 3550889) has the molecular formula C23H22F3N3O and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-[(1-benzylpyrrol-2-yl)methyl]-1-cyclopropyl-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1-benzylpyrrol-2-yl)methyl]-1-cyclopropyl-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3550889 |
| Molecular Formula | C23H22F3N3O |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-[(1-benzylpyrrol-2-yl)methyl]-1-cyclopropyl-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N(Cc1cccn1Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C23H22F3N3O/c24-23(25,26)20-10-4-5-11-21(20)27-22(30)29(18-12-13-18)16-19-9-6-14-28(19)15-17-7-2-1-3-8-17/h1-11,14,18H,12-13,15-16H2,(H,27,30) |
| InChIKey | XSVZPEOSUGZWRQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |