C17H20F3N3O — CID 42760075
1-[(1-methylpyrrol-2-yl)methyl]-1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 42760075) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 1-[(1-methylpyrrol-2-yl)methyl]-1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1-methylpyrrol-2-yl)methyl]-1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42760075 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(1-methylpyrrol-2-yl)methyl]-1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)N(Cc1cccn1C)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O/c1-12(2)23(11-13-7-6-10-22(13)3)16(24)21-15-9-5-4-8-14(15)17(18,19)20/h4-10,12H,11H2,1-3H3,(H,21,24) |
| InChIKey | AYJJBMLYAYLNGK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |