C24H35N3O3 — CID 5121435
N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enyloctanamide (PubChem CID 5121435) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enyloctanamide.
| Compound Name | N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enyloctanamide |
|---|---|
| PubChem CID | 5121435 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | N-[2-[furan-2-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enyloctanamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccco1)Cc1cccn1C)C(=O)CCCCCCC |
| InChI | InChI=1S/C24H35N3O3/c1-4-6-7-8-9-14-23(28)26(15-5-2)20-24(29)27(19-22-13-11-17-30-22)18-21-12-10-16-25(21)3/h5,10-13,16-17H,2,4,6-9,14-15,18-20H2,1,3H3 |
| InChIKey | JPBLUWHGTPFFKC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|