C23H25BrN4O3 — CID 3876308
2-[(3-bromophenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3876308) has the molecular formula C23H25BrN4O3 and a molecular weight of 485.38 g/mol. Its IUPAC name is 2-[(3-bromophenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[(3-bromophenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3876308 |
| Molecular Formula | C23H25BrN4O3 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-[(3-bromophenyl)carbamoyl-prop-2-enylamino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccco1)Cc1cccn1C)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C23H25BrN4O3/c1-3-11-27(23(30)25-19-8-4-7-18(24)14-19)17-22(29)28(16-21-10-6-13-31-21)15-20-9-5-12-26(20)2/h3-10,12-14H,1,11,15-17H2,2H3,(H,25,30) |
| InChIKey | KIEZAUHOSHUMTK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|