C21H27BrN4O3 — CID 3270179
2-[(4-bromophenyl)carbamoyl-prop-2-enylamino]-N-(2-methoxyethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3270179) has the molecular formula C21H27BrN4O3 and a molecular weight of 463.38 g/mol. Its IUPAC name is 2-[(4-bromophenyl)carbamoyl-prop-2-enylamino]-N-(2-methoxyethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)carbamoyl-prop-2-enylamino]-N-(2-methoxyethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3270179 |
| Molecular Formula | C21H27BrN4O3 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[(4-bromophenyl)carbamoyl-prop-2-enylamino]-N-(2-methoxyethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(CCOC)Cc1cccn1C)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H27BrN4O3/c1-4-11-26(21(28)23-18-9-7-17(22)8-10-18)16-20(27)25(13-14-29-3)15-19-6-5-12-24(19)2/h4-10,12H,1,11,13-16H2,2-3H3,(H,23,28) |
| InChIKey | ZZDKLEXYOWSIMC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|