C23H30N4O3 — CID 4575090
N-cyclopropyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 4575090) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-cyclopropyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | N-cyclopropyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4575090 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-cyclopropyl-2-[(4-ethoxyphenyl)carbamoyl-prop-2-enylamino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-4-14-26(23(29)24-18-8-12-21(13-9-18)30-5-2)17-22(28)27(19-10-11-19)16-20-7-6-15-25(20)3/h4,6-9,12-13,15,19H,1,5,10-11,14,16-17H2,2-3H3,(H,24,29) |
| InChIKey | FYUMGPBHDGRVRH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|