C20H31N3O2 — CID 42770766
N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylhexanamide (PubChem CID 42770766) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylhexanamide.
| Compound Name | N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylhexanamide |
|---|---|
| PubChem CID | 42770766 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylhexanamide |
| SMILES | C=CCN(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)CCCCC |
| InChI | InChI=1S/C20H31N3O2/c1-4-6-7-10-19(24)22(13-5-2)16-20(25)23(17-11-12-17)15-18-9-8-14-21(18)3/h5,8-9,14,17H,2,4,6-7,10-13,15-16H2,1,3H3 |
| InChIKey | NFLDMEUPSVTENH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|