C25H38N4O3 — CID 3650210
N-butyl-2-[(4-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3650210) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-butyl-2-[(4-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | N-butyl-2-[(4-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3650210 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | N-butyl-2-[(4-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(CCCOC)C(=O)Nc1ccc(CC)cc1 |
| InChI | InChI=1S/C25H38N4O3/c1-5-7-16-28(19-23-10-8-15-27(23)3)24(30)20-29(17-9-18-32-4)25(31)26-22-13-11-21(6-2)12-14-22/h8,10-15H,5-7,9,16-20H2,1-4H3,(H,26,31) |
| InChIKey | VNHPSBBWBHGAGU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|