C18H25N3O2S — CID 4317615
1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]-3-(4-methylsulfanylphenyl)urea (PubChem CID 4317615) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 4317615 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]-3-(4-methylsulfanylphenyl)urea |
| SMILES | COCCCN(Cc1cccn1C)C(=O)Nc1ccc(SC)cc1 |
| InChI | InChI=1S/C18H25N3O2S/c1-20-11-4-6-16(20)14-21(12-5-13-23-2)18(22)19-15-7-9-17(24-3)10-8-15/h4,6-11H,5,12-14H2,1-3H3,(H,19,22) |
| InChIKey | KGQYBTOJSHQTNS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|