C17H21Cl2N3O2 — CID 42662613
3-(2,6-dichlorophenyl)-1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]urea (PubChem CID 42662613) has the molecular formula C17H21Cl2N3O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]urea.
| Compound Name | 3-(2,6-dichlorophenyl)-1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 42662613 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-(3-methoxypropyl)-1-[(1-methylpyrrol-2-yl)methyl]urea |
| SMILES | COCCCN(Cc1cccn1C)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O2/c1-21-9-4-6-13(21)12-22(10-5-11-24-2)17(23)20-16-14(18)7-3-8-15(16)19/h3-4,6-9H,5,10-12H2,1-2H3,(H,20,23) |
| InChIKey | HOFMSONRXYTKJS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|