C19H26N2O4 — CID 4317190
2,6-dimethoxy-N-(3-methoxypropyl)-N-[(1-methylpyrrol-2-yl)methyl]benzamide (PubChem CID 4317190) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2,6-dimethoxy-N-(3-methoxypropyl)-N-[(1-methylpyrrol-2-yl)methyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-(3-methoxypropyl)-N-[(1-methylpyrrol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4317190 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2,6-dimethoxy-N-(3-methoxypropyl)-N-[(1-methylpyrrol-2-yl)methyl]benzamide |
| SMILES | COCCCN(Cc1cccn1C)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H26N2O4/c1-20-11-6-8-15(20)14-21(12-7-13-23-2)19(22)18-16(24-3)9-5-10-17(18)25-4/h5-6,8-11H,7,12-14H2,1-4H3 |
| InChIKey | FHXSVXKFHFBTFP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|