C31H41BrN4O3 — CID 5115521
N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(3-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]acetamide (PubChem CID 5115521) has the molecular formula C31H41BrN4O3 and a molecular weight of 597.60 g/mol. Its IUPAC name is N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(3-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]acetamide.
| Compound Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(3-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]acetamide |
|---|---|
| PubChem CID | 5115521 |
| Molecular Formula | C31H41BrN4O3 |
| Molecular Weight | 597.60 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-butyl-2-[(3-ethylphenyl)carbamoyl-(3-methoxypropyl)amino]acetamide |
| SMILES | CCCCN(Cc1cccn1Cc1ccc(Br)cc1)C(=O)CN(CCCOC)C(=O)Nc1cccc(CC)c1 |
| InChI | InChI=1S/C31H41BrN4O3/c1-4-6-17-35(23-29-12-8-18-34(29)22-26-13-15-27(32)16-14-26)30(37)24-36(19-9-20-39-3)31(38)33-28-11-7-10-25(5-2)21-28/h7-8,10-16,18,21H,4-6,9,17,19-20,22-24H2,1-3H3,(H,33,38) |
| InChIKey | OWLMNWWKYDLBSK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|