C31H41N3O3 — CID 4011712
N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide (PubChem CID 4011712) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 4011712 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCOC)CC(=O)N(Cc2ccccc2)Cc2cccn2C)cc1 |
| InChI | InChI=1S/C31H41N3O3/c1-4-5-6-8-12-26-16-18-28(19-17-26)31(36)33(21-22-37-3)25-30(35)34(23-27-13-9-7-10-14-27)24-29-15-11-20-32(29)2/h7,9-11,13-20H,4-6,8,12,21-25H2,1-3H3 |
| InChIKey | KKUZJOVPXSIWMT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|