C32H34N4O4 — CID 4618211
N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propan-2-ylbenzamide (PubChem CID 4618211) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4618211 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-[2-[benzyl-[(1-benzylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CC(=O)N(Cc2ccccc2)Cc2cccn2Cc2ccccc2)C(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H34N4O4/c1-24(2)35(32(38)28-17-16-25(3)30(19-28)36(39)40)23-31(37)34(21-27-13-8-5-9-14-27)22-29-15-10-18-33(29)20-26-11-6-4-7-12-26/h4-19,24H,20-23H2,1-3H3 |
| InChIKey | NZFQLWPYXUJUQN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|