C28H34N4O5 — CID 4567287
N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-4-methyl-3-nitrobenzamide (PubChem CID 4567287) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4567287 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)-4-methyl-3-nitrobenzamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1C)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H34N4O5/c1-4-37-17-9-16-30(28(34)24-14-13-22(2)26(18-24)32(35)36)21-27(33)31(19-23-10-6-5-7-11-23)20-25-12-8-15-29(25)3/h5-8,10-15,18H,4,9,16-17,19-21H2,1-3H3 |
| InChIKey | VUWRSKNRKUAVFD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|