C13H18Cl2N2O2 — CID 30027
2-(diethylamino)ethyl N-(2,5-dichlorophenyl)carbamate (PubChem CID 30027) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2-(diethylamino)ethyl N-(2,5-dichlorophenyl)carbamate.
| Compound Name | 2-(diethylamino)ethyl N-(2,5-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 30027 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(diethylamino)ethyl N-(2,5-dichlorophenyl)carbamate |
| SMILES | CCN(CC)CCOC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-3-17(4-2)7-8-19-13(18)16-12-9-10(14)5-6-11(12)15/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | QAYKGISUAWAQAY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |