C9H8BrCl2NO2 — CID 4092025
2-bromoethyl N-(2,4-dichlorophenyl)carbamate (PubChem CID 4092025) has the molecular formula C9H8BrCl2NO2 and a molecular weight of 312.98 g/mol. Its IUPAC name is 2-bromoethyl N-(2,4-dichlorophenyl)carbamate.
| Compound Name | 2-bromoethyl N-(2,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 4092025 |
| Molecular Formula | C9H8BrCl2NO2 |
| Molecular Weight | 312.98 g/mol |
| Exact Mass | 310.91 |
| IUPAC Name | 2-bromoethyl N-(2,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)OCCBr |
| InChI | InChI=1S/C9H8BrCl2NO2/c10-3-4-15-9(14)13-8-2-1-6(11)5-7(8)12/h1-2,5H,3-4H2,(H,13,14) |
| InChIKey | LOCAVVBLFAKVJZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|