C10H7Cl2NO2 — CID 534035
prop-2-ynyl N-(2,4-dichlorophenyl)carbamate (PubChem CID 534035) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is prop-2-ynyl N-(2,4-dichlorophenyl)carbamate.
| Compound Name | prop-2-ynyl N-(2,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 534035 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | prop-2-ynyl N-(2,4-dichlorophenyl)carbamate |
| SMILES | C#CCOC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NO2/c1-2-5-15-10(14)13-9-4-3-7(11)6-8(9)12/h1,3-4,6H,5H2,(H,13,14) |
| InChIKey | KWHPHVVVXTYHLS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|