C12H8Cl2O3 — CID 3016818
prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate (PubChem CID 3016818) has the molecular formula C12H8Cl2O3 and a molecular weight of 271.10 g/mol. Its IUPAC name is prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate.
| Compound Name | prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 3016818 |
| Molecular Formula | C12H8Cl2O3 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate |
| SMILES | C#CCOC(=O)C=COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2O3/c1-2-6-17-12(15)5-7-16-11-4-3-9(13)8-10(11)14/h1,3-5,7-8H,6H2 |
| InChIKey | XUISHRXMJFAYGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|