C17H13Cl2N3O2 — CID 158653125
(E)-3-(2,4-dichlorophenoxy)-N-(3H-indol-2-yl)prop-2-enehydrazide (PubChem CID 158653125) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenoxy)-N-(3H-indol-2-yl)prop-2-enehydrazide.
| Compound Name | (E)-3-(2,4-dichlorophenoxy)-N-(3H-indol-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 158653125 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | (E)-3-(2,4-dichlorophenoxy)-N-(3H-indol-2-yl)prop-2-enehydrazide |
| SMILES | NN(C(=O)/C=C/Oc1ccc(Cl)cc1Cl)C1=Nc2ccccc2C1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c18-12-5-6-15(13(19)10-12)24-8-7-17(23)22(20)16-9-11-3-1-2-4-14(11)21-16/h1-8,10H,9,20H2/b8-7+ |
| InChIKey | IBUJDXAZGRORCI-BQYQJAHWSA-N |
| XLogP | 3.87 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|