C13H18Cl2N2O2 — CID 79337552
(2-amino-2-ethylbutyl) N-(2,5-dichlorophenyl)carbamate (PubChem CID 79337552) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is (2-amino-2-ethylbutyl) N-(2,5-dichlorophenyl)carbamate.
| Compound Name | (2-amino-2-ethylbutyl) N-(2,5-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 79337552 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2-amino-2-ethylbutyl) N-(2,5-dichlorophenyl)carbamate |
| SMILES | CCC(N)(CC)COC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-3-13(16,4-2)8-19-12(18)17-11-7-9(14)5-6-10(11)15/h5-7H,3-4,8,16H2,1-2H3,(H,17,18) |
| InChIKey | FORUQAIWRVNOCR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |