C11H12Cl2N2O3 — CID 43624007
methyl 2-[(2,5-dichlorophenyl)carbamoyl-methylamino]acetate (PubChem CID 43624007) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is methyl 2-[(2,5-dichlorophenyl)carbamoyl-methylamino]acetate.
| Compound Name | methyl 2-[(2,5-dichlorophenyl)carbamoyl-methylamino]acetate |
|---|---|
| PubChem CID | 43624007 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | methyl 2-[(2,5-dichlorophenyl)carbamoyl-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c1-15(6-10(16)18-2)11(17)14-9-5-7(12)3-4-8(9)13/h3-5H,6H2,1-2H3,(H,14,17) |
| InChIKey | YTLFENRVDCXMAR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |