C23H22ClN3O3S — CID 34542770
N-[2-chloro-5-[[4-(diethylcarbamoyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 34542770) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is N-[2-chloro-5-[[4-(diethylcarbamoyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[[4-(diethylcarbamoyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 34542770 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[2-chloro-5-[[4-(diethylcarbamoyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc(Cl)c(NC(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-3-27(4-2)23(30)15-7-10-17(11-8-15)25-21(28)16-9-12-18(24)19(14-16)26-22(29)20-6-5-13-31-20/h5-14H,3-4H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | TTYARDQWJPFZSZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |