C14H12ClN3O3S — CID 43006993
N-[5-(acetamidocarbamoyl)-2-chlorophenyl]thiophene-2-carboxamide (PubChem CID 43006993) has the molecular formula C14H12ClN3O3S and a molecular weight of 337.79 g/mol. Its IUPAC name is N-[5-(acetamidocarbamoyl)-2-chlorophenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-(acetamidocarbamoyl)-2-chlorophenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 43006993 |
| Molecular Formula | C14H12ClN3O3S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-[5-(acetamidocarbamoyl)-2-chlorophenyl]thiophene-2-carboxamide |
| SMILES | CC(=O)NNC(=O)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H12ClN3O3S/c1-8(19)17-18-13(20)9-4-5-10(15)11(7-9)16-14(21)12-3-2-6-22-12/h2-7H,1H3,(H,16,21)(H,17,19)(H,18,20) |
| InChIKey | AVNFZLBLJFTHRE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|