About N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide
N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide (PubChem CID 108512739) has the molecular formula C17H16ClN3O4
and a molecular weight of 361.79 g/mol. Its IUPAC name is N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide.
Molecular Properties
| Compound Name | N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide |
| PubChem CID | 108512739 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16ClN3O4/c1-2-20(11-12-6-4-3-5-7-12)17(23)16(22)19-13-8-9-14(18)15(10-13)21(24)25/h3-10H,2,11H2,1H3,(H,19,22) |
| InChIKey | BRFAYTWPVOJJNL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide?
The IUPAC name of N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide (CID 108512739) is N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide.
What is the SMILES notation for N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide?
The canonical SMILES for N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide is CCN(Cc1ccccc1)C(=O)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide?
The InChIKey is BRFAYTWPVOJJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O4/c1-2-20(11-12-6-4-3-5-7-12)17(23)16(22)19-13-8-9-14(18)15(10-13)21(24)25/h3-10H,2,11H2,1H3,(H,19,22).
What are the key properties of N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide?
N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide has a molecular weight of 361.79 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-(4-chloro-3-nitrophenyl)-N'-ethyloxamide is sourced from PubChem (CID 108512739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).