C35H44F2N2O5 — CID 10211024
3-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethoxy]phenyl]-2-methyl-2-(4-propan-2-ylphenoxy)propanoic acid (PubChem CID 10211024) has the molecular formula C35H44F2N2O5 and a molecular weight of 610.74 g/mol. Its IUPAC name is 3-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethoxy]phenyl]-2-methyl-2-(4-propan-2-ylphenoxy)propanoic acid.
| Compound Name | 3-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethoxy]phenyl]-2-methyl-2-(4-propan-2-ylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 10211024 |
| Molecular Formula | C35H44F2N2O5 |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | 3-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethoxy]phenyl]-2-methyl-2-(4-propan-2-ylphenoxy)propanoic acid |
| SMILES | CCCCCCCN(CCOc1ccc(CC(C)(Oc2ccc(C(C)C)cc2)C(=O)O)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C35H44F2N2O5/c1-5-6-7-8-9-20-39(34(42)38-32-19-14-28(36)23-31(32)37)21-22-43-29-15-10-26(11-16-29)24-35(4,33(40)41)44-30-17-12-27(13-18-30)25(2)3/h10-19,23,25H,5-9,20-22,24H2,1-4H3,(H,38,42)(H,40,41) |
| InChIKey | HPTZYZRVCVNCLM-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|