C29H42N2O6 — CID 67686088
2-[4-[3-[(2,6-dimethoxyphenyl)carbamoyl-heptylamino]propyl]phenoxy]-2-methylpropanoic acid (PubChem CID 67686088) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is 2-[4-[3-[(2,6-dimethoxyphenyl)carbamoyl-heptylamino]propyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-[(2,6-dimethoxyphenyl)carbamoyl-heptylamino]propyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 67686088 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 2-[4-[3-[(2,6-dimethoxyphenyl)carbamoyl-heptylamino]propyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCN(CCCc1ccc(OC(C)(C)C(=O)O)cc1)C(=O)Nc1c(OC)cccc1OC |
| InChI | InChI=1S/C29H42N2O6/c1-6-7-8-9-10-20-31(28(34)30-26-24(35-4)14-11-15-25(26)36-5)21-12-13-22-16-18-23(19-17-22)37-29(2,3)27(32)33/h11,14-19H,6-10,12-13,20-21H2,1-5H3,(H,30,34)(H,32,33) |
| InChIKey | LKIMQUCOKKIPEH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|