C28H37F3N2O5 — CID 10280378
(2R)-2-[3-[2-[heptyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethyl]phenoxy]-2-methylbutanoic acid (PubChem CID 10280378) has the molecular formula C28H37F3N2O5 and a molecular weight of 538.61 g/mol. Its IUPAC name is (2R)-2-[3-[2-[heptyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethyl]phenoxy]-2-methylbutanoic acid.
| Compound Name | (2R)-2-[3-[2-[heptyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethyl]phenoxy]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 10280378 |
| Molecular Formula | C28H37F3N2O5 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (2R)-2-[3-[2-[heptyl-[[4-(trifluoromethoxy)phenyl]carbamoyl]amino]ethyl]phenoxy]-2-methylbutanoic acid |
| SMILES | CCCCCCCN(CCc1cccc(O[C@](C)(CC)C(=O)O)c1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C28H37F3N2O5/c1-4-6-7-8-9-18-33(26(36)32-22-13-15-23(16-14-22)38-28(29,30)31)19-17-21-11-10-12-24(20-21)37-27(3,5-2)25(34)35/h10-16,20H,4-9,17-19H2,1-3H3,(H,32,36)(H,34,35)/t27-/m1/s1 |
| InChIKey | RGBIXKYBVMVESU-HHHXNRCGSA-N |
| XLogP | 7.26 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|