C24H22ClNO6S — CID 66978830
4-[[2-(2-acetyloxyphenyl)ethyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid (PubChem CID 66978830) has the molecular formula C24H22ClNO6S and a molecular weight of 487.96 g/mol. Its IUPAC name is 4-[[2-(2-acetyloxyphenyl)ethyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-(2-acetyloxyphenyl)ethyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 66978830 |
| Molecular Formula | C24H22ClNO6S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 4-[[2-(2-acetyloxyphenyl)ethyl-(4-chlorophenyl)sulfonylamino]methyl]benzoic acid |
| SMILES | CC(=O)Oc1ccccc1CCN(Cc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClNO6S/c1-17(27)32-23-5-3-2-4-19(23)14-15-26(16-18-6-8-20(9-7-18)24(28)29)33(30,31)22-12-10-21(25)11-13-22/h2-13H,14-16H2,1H3,(H,28,29) |
| InChIKey | FDAYNCYLTLDUIY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|