C29H33ClN2O4S — CID 66978858
4-[[(4-chlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]-N-(oxan-4-ylmethyl)benzamide (PubChem CID 66978858) has the molecular formula C29H33ClN2O4S and a molecular weight of 541.11 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]-N-(oxan-4-ylmethyl)benzamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]-N-(oxan-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 66978858 |
| Molecular Formula | C29H33ClN2O4S |
| Molecular Weight | 541.11 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]-N-(oxan-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCOCC1)c1ccc(CN(CCCc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H33ClN2O4S/c30-27-12-14-28(15-13-27)37(34,35)32(18-4-7-23-5-2-1-3-6-23)22-25-8-10-26(11-9-25)29(33)31-21-24-16-19-36-20-17-24/h1-3,5-6,8-15,24H,4,7,16-22H2,(H,31,33) |
| InChIKey | ZGLIWOHMPKCLRI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.11 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |