C28H31ClN2O3S — CID 4964811
4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]-N-(2-methylcyclohexyl)benzamide (PubChem CID 4964811) has the molecular formula C28H31ClN2O3S and a molecular weight of 511.09 g/mol. Its IUPAC name is 4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]-N-(2-methylcyclohexyl)benzamide.
| Compound Name | 4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]-N-(2-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 4964811 |
| Molecular Formula | C28H31ClN2O3S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 4-[[benzyl-(4-chlorophenyl)sulfonylamino]methyl]-N-(2-methylcyclohexyl)benzamide |
| SMILES | CC1CCCCC1NC(=O)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H31ClN2O3S/c1-21-7-5-6-10-27(21)30-28(32)24-13-11-23(12-14-24)20-31(19-22-8-3-2-4-9-22)35(33,34)26-17-15-25(29)16-18-26/h2-4,8-9,11-18,21,27H,5-7,10,19-20H2,1H3,(H,30,32) |
| InChIKey | CJHJUXZRWUMRCW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |