C18H16ClN3O2S — CID 70828971
N-(6-amino-3-pyridinyl)-N-[(4-chlorophenyl)methyl]benzenesulfonamide (PubChem CID 70828971) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-N-[(4-chlorophenyl)methyl]benzenesulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)-N-[(4-chlorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70828971 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-N-[(4-chlorophenyl)methyl]benzenesulfonamide |
| SMILES | Nc1ccc(N(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C18H16ClN3O2S/c19-15-8-6-14(7-9-15)13-22(16-10-11-18(20)21-12-16)25(23,24)17-4-2-1-3-5-17/h1-12H,13H2,(H2,20,21) |
| InChIKey | FUMMSDSYVCDQLT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |