C39H40N2O4 — CID 10393807
3-[3-[benzyl-[2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]amino]propyl]benzamide (PubChem CID 10393807) has the molecular formula C39H40N2O4 and a molecular weight of 600.76 g/mol. Its IUPAC name is 3-[3-[benzyl-[2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]amino]propyl]benzamide.
| Compound Name | 3-[3-[benzyl-[2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 10393807 |
| Molecular Formula | C39H40N2O4 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | 3-[3-[benzyl-[2-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]amino]propyl]benzamide |
| SMILES | NC(=O)c1cccc(CCCN(Cc2ccccc2)CC(O)c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C39H40N2O4/c40-39(43)35-20-10-18-30(24-35)19-11-23-41(26-31-12-4-1-5-13-31)27-36(42)34-21-22-37(44-28-32-14-6-2-7-15-32)38(25-34)45-29-33-16-8-3-9-17-33/h1-10,12-18,20-22,24-25,36,42H,11,19,23,26-29H2,(H2,40,43) |
| InChIKey | RWISLHYQMMXBAA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |