C32H34N2O3 — CID 10278330
3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]benzamide (PubChem CID 10278330) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]benzamide.
| Compound Name | 3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]benzamide |
|---|---|
| PubChem CID | 10278330 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]benzamide |
| SMILES | COc1ccc(CN(CCCOc2cccc(C(N)=O)c2)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-36-29-18-16-25(17-19-29)23-34(20-9-21-37-30-15-8-14-28(22-30)32(33)35)24-31(26-10-4-2-5-11-26)27-12-6-3-7-13-27/h2-8,10-19,22,31H,9,20-21,23-24H2,1H3,(H2,33,35) |
| InChIKey | DLZAEQUGCHBQCU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|