C34H37NO4 — CID 10165098
methyl 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetate (PubChem CID 10165098) has the molecular formula C34H37NO4 and a molecular weight of 523.67 g/mol. Its IUPAC name is methyl 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetate |
|---|---|
| PubChem CID | 10165098 |
| Molecular Formula | C34H37NO4 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | methyl 2-[3-[3-[2,2-diphenylethyl-[(4-methoxyphenyl)methyl]amino]propoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(OCCCN(Cc2ccc(OC)cc2)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C34H37NO4/c1-37-31-19-17-27(18-20-31)25-35(21-10-22-39-32-16-9-11-28(23-32)24-34(36)38-2)26-33(29-12-5-3-6-13-29)30-14-7-4-8-15-30/h3-9,11-20,23,33H,10,21-22,24-26H2,1-2H3 |
| InChIKey | RVUGLDRPUFGNKP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|