C26H27F2NO3 — CID 68993184
methyl 2-[3-[3-[2,2-bis(3-fluorophenyl)ethylamino]propoxy]phenyl]acetate (PubChem CID 68993184) has the molecular formula C26H27F2NO3 and a molecular weight of 439.50 g/mol. Its IUPAC name is methyl 2-[3-[3-[2,2-bis(3-fluorophenyl)ethylamino]propoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[3-[2,2-bis(3-fluorophenyl)ethylamino]propoxy]phenyl]acetate |
|---|---|
| PubChem CID | 68993184 |
| Molecular Formula | C26H27F2NO3 |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | methyl 2-[3-[3-[2,2-bis(3-fluorophenyl)ethylamino]propoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(OCCCNCC(c2cccc(F)c2)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H27F2NO3/c1-31-26(30)15-19-6-2-11-24(14-19)32-13-5-12-29-18-25(20-7-3-9-22(27)16-20)21-8-4-10-23(28)17-21/h2-4,6-11,14,16-17,25,29H,5,12-13,15,18H2,1H3 |
| InChIKey | XWPDHVQCISQREX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|