C34H36N2O2 — CID 10207449
2-[3-[3-[2,2-diphenylethyl-[(E)-3-phenylprop-2-enyl]amino]propoxy]phenyl]acetamide (PubChem CID 10207449) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-[3-[3-[2,2-diphenylethyl-[(E)-3-phenylprop-2-enyl]amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[2,2-diphenylethyl-[(E)-3-phenylprop-2-enyl]amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10207449 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 2-[3-[3-[2,2-diphenylethyl-[(E)-3-phenylprop-2-enyl]amino]propoxy]phenyl]acetamide |
| SMILES | NC(=O)Cc1cccc(OCCCN(C/C=C/c2ccccc2)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C34H36N2O2/c35-34(37)26-29-15-10-21-32(25-29)38-24-12-23-36(22-11-16-28-13-4-1-5-14-28)27-33(30-17-6-2-7-18-30)31-19-8-3-9-20-31/h1-11,13-21,25,33H,12,22-24,26-27H2,(H2,35,37)/b16-11+ |
| InChIKey | DHANQYIKHLMMBY-LFIBNONCSA-N |
| XLogP | 6.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|