C38H45N3O2 — CID 10231791
2-[3-[3-[2,2-diphenylethyl-[1-(2-phenylethyl)piperidin-4-yl]amino]propoxy]phenyl]acetamide (PubChem CID 10231791) has the molecular formula C38H45N3O2 and a molecular weight of 575.80 g/mol. Its IUPAC name is 2-[3-[3-[2,2-diphenylethyl-[1-(2-phenylethyl)piperidin-4-yl]amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[2,2-diphenylethyl-[1-(2-phenylethyl)piperidin-4-yl]amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10231791 |
| Molecular Formula | C38H45N3O2 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | 2-[3-[3-[2,2-diphenylethyl-[1-(2-phenylethyl)piperidin-4-yl]amino]propoxy]phenyl]acetamide |
| SMILES | NC(=O)Cc1cccc(OCCCN(CC(c2ccccc2)c2ccccc2)C2CCN(CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C38H45N3O2/c39-38(42)29-32-14-10-19-36(28-32)43-27-11-23-41(30-37(33-15-6-2-7-16-33)34-17-8-3-9-18-34)35-21-25-40(26-22-35)24-20-31-12-4-1-5-13-31/h1-10,12-19,28,35,37H,11,20-27,29-30H2,(H2,39,42) |
| InChIKey | KZZAKCQGMSLDCX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|