C31H36N2O3 — CID 10116944
2-[3-[3-[3,4-dihydro-2H-pyran-2-ylmethyl(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide (PubChem CID 10116944) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[3-[3-[3,4-dihydro-2H-pyran-2-ylmethyl(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide.
| Compound Name | 2-[3-[3-[3,4-dihydro-2H-pyran-2-ylmethyl(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10116944 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 2-[3-[3-[3,4-dihydro-2H-pyran-2-ylmethyl(2,2-diphenylethyl)amino]propoxy]phenyl]acetamide |
| SMILES | NC(=O)Cc1cccc(OCCCN(CC2CCC=CO2)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H36N2O3/c32-31(34)22-25-11-9-17-28(21-25)35-20-10-18-33(23-29-16-7-8-19-36-29)24-30(26-12-3-1-4-13-26)27-14-5-2-6-15-27/h1-6,8-9,11-15,17,19,21,29-30H,7,10,16,18,20,22-24H2,(H2,32,34) |
| InChIKey | BFITWMFBJFSFLY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|