C27H28F3NO3 — CID 59701448
2-[3-[3-[[(2R)-2-phenylpropyl]-[(2,4,5-trifluorophenyl)methyl]amino]propoxy]phenyl]acetic acid (PubChem CID 59701448) has the molecular formula C27H28F3NO3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[3-[3-[[(2R)-2-phenylpropyl]-[(2,4,5-trifluorophenyl)methyl]amino]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[[(2R)-2-phenylpropyl]-[(2,4,5-trifluorophenyl)methyl]amino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 59701448 |
| Molecular Formula | C27H28F3NO3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[3-[3-[[(2R)-2-phenylpropyl]-[(2,4,5-trifluorophenyl)methyl]amino]propoxy]phenyl]acetic acid |
| SMILES | C[C@@H](CN(CCCOc1cccc(CC(=O)O)c1)Cc1cc(F)c(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C27H28F3NO3/c1-19(21-8-3-2-4-9-21)17-31(18-22-15-25(29)26(30)16-24(22)28)11-6-12-34-23-10-5-7-20(13-23)14-27(32)33/h2-5,7-10,13,15-16,19H,6,11-12,14,17-18H2,1H3,(H,32,33)/t19-/m0/s1 |
| InChIKey | FDPJUPOJPSAXOT-IBGZPJMESA-N |
| XLogP | 5.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|